Products 139123-65-2
CAS 139123-65-2 appears in our catalog under these names: 6-Amino-4-hydroxynaphthalene-2-sulfonic acid hydrate, 90%, 90%, 2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-, hydrate (1:1). Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 25g.
6-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate (CAS 139123-65-2) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 6-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate. InChIKey: UDDZFUCCXGYYGP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 6-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate |
| InChIKey | UDDZFUCCXGYYGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)O)N.O |
Computed by PubChem (NCBI)
Synonyms:
6-Amino-4-hydroxy-2-naphthalenesulfonic acid monohydrate, 2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-, monohydrate, 6-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate, UDDZFUCCXGYYGP-UHFFFAOYSA-N, 6-Amino-4-hydroxynaphthalene-2-sulfonic acid--water (1/1), 6-Amino-4-hydroxy-2-naphthalenesulfonic acid monohydrate, 90%