Products 1307237-63-3

CAS 1307237-63-3 is the registry number for 3-((4-Formylphenyl)sulfonamido)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[(4-formylphenyl)sulfonylamino]propanoic acid (CAS 1307237-63-3) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 3-[(4-formylphenyl)sulfonylamino]propanoic acid. InChIKey: WZJNZBAXDZLOSD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO5S
Molecular weight257.27 g/mol
IUPAC name3-[(4-formylphenyl)sulfonylamino]propanoic acid
InChIKeyWZJNZBAXDZLOSD-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=O)S(=O)(=O)NCCC(=O)O

Computed by PubChem (NCBI)