CAS 1307237-63-3 is the registry number for 3-((4-Formylphenyl)sulfonamido)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-formylphenyl)sulfonylamino]propanoic acid (CAS 1307237-63-3) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 3-[(4-formylphenyl)sulfonylamino]propanoic acid. InChIKey: WZJNZBAXDZLOSD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 3-[(4-formylphenyl)sulfonylamino]propanoic acid |
| InChIKey | WZJNZBAXDZLOSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)