Products 1016741-14-2
CAS 1016741-14-2 is the registry number for 4-((Methylcarbamoyl)methanesulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid (CAS 1016741-14-2) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid. InChIKey: IKXFKWCVSHAAGX-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid |
| InChIKey | IKXFKWCVSHAAGX-UHFFFAOYSA-N |
| SMILES | CNC(=O)CS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)