CAS 885532-14-9 appears in our catalog under these names: 6-Sulfamoyl-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid, 95%, 6-Sulfamoyl-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 885532-14-9) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: JPLWTCNEAYJRLQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | JPLWTCNEAYJRLQ-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=C(C=C2)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)