CAS 790270-98-3 is the registry number for ([(3-Acetylphenyl)sulfonyl]amino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(3-acetylphenyl)sulfonylamino]acetic acid (CAS 790270-98-3) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 2-[(3-acetylphenyl)sulfonylamino]acetic acid. InChIKey: HINKTCFJKCXJFA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 2-[(3-acetylphenyl)sulfonylamino]acetic acid |
| InChIKey | HINKTCFJKCXJFA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)