CAS 924871-08-9 is the registry number for 3-(4-Methoxy-3-sulfamoylphenyl)acrylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(E)-3-(4-methoxy-3-sulfamoylphenyl)prop-2-enoic acid (CAS 924871-08-9) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: (E)-3-(4-methoxy-3-sulfamoylphenyl)prop-2-enoic acid. InChIKey: FCBAZVFULZYDEN-HWKANZROSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | (E)-3-(4-methoxy-3-sulfamoylphenyl)prop-2-enoic acid |
| InChIKey | FCBAZVFULZYDEN-HWKANZROSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)