Products 749920-47-6
CAS 749920-47-6 appears in our catalog under these names: ([(4-Acetylphenyl)sulfonyl]amino)acetic acid, 95%, 2-(4-Acetylbenzenesulfonamido)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[(4-acetylphenyl)sulfonylamino]acetic acid (CAS 749920-47-6) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 2-[(4-acetylphenyl)sulfonylamino]acetic acid. InChIKey: LBUSREIZWCQXBJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 2-[(4-acetylphenyl)sulfonylamino]acetic acid |
| InChIKey | LBUSREIZWCQXBJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-acetylbenzenesulfonamido)acetic acid, {[(4-acetylphenyl)sulfonyl]amino}acetic acid, 2-[(4-acetylphenyl)sulfonylamino]acetic Acid, ([(4-acetylphenyl)sulfonyl]amino)acetic acid, LBUSREIZWCQXBJ-UHFFFAOYSA-N, (4-acetylbenzenesulfonylamino)acetic acid, 2-(4-acetylbenzenesulfonamido)aceticacid