CAS 1016498-95-5 is the registry number for 3-{4H,5H,6H-cyclopenta(b)thiophene-2-amido}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoic acid (CAS 1016498-95-5) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 3-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoic acid. InChIKey: PGYCOJMXQYXARW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 3-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoic acid |
| InChIKey | PGYCOJMXQYXARW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2)C(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)