CAS 2172481-73-9 is the registry number for Methyl 2-(1-benzofuran-2-yl)-4-ethyl-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-(1-benzofuran-2-yl)-4-ethyl-1,3-thiazole-5-carboxylate (CAS 2172481-73-9) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: methyl 2-(1-benzofuran-2-yl)-4-ethyl-1,3-thiazole-5-carboxylate. InChIKey: BDWVNMIPROQSCM-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | methyl 2-(1-benzofuran-2-yl)-4-ethyl-1,3-thiazole-5-carboxylate |
| InChIKey | BDWVNMIPROQSCM-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=N1)C2=CC3=CC=CC=C3O2)C(=O)OC |
Computed by PubChem (NCBI)