CAS 1017021-25-8 is the registry number for 4-{((4-carbamoylphenyl)methyl)sulfanyl}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(4-carbamoylphenyl)methylsulfanyl]benzoic acid (CAS 1017021-25-8) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 4-[(4-carbamoylphenyl)methylsulfanyl]benzoic acid. InChIKey: QVSMWXCDPOMIQQ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 4-[(4-carbamoylphenyl)methylsulfanyl]benzoic acid |
| InChIKey | QVSMWXCDPOMIQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC2=CC=C(C=C2)C(=O)O)C(=O)N |
Computed by PubChem (NCBI)