CAS 1019383-42-6 appears in our catalog under these names: 2-(2,3-Dihydro-1h-indene-5-amido)thiophene-3-carboxylic acid, 95%, 2-(2,3-Dihydro-1H-indene-5-amido)thiophene-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(2,3-dihydro-1H-indene-5-carbonylamino)thiophene-3-carboxylic acid (CAS 1019383-42-6) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 2-(2,3-dihydro-1H-indene-5-carbonylamino)thiophene-3-carboxylic acid. InChIKey: HDZMVOKNJNGOLN-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-indene-5-carbonylamino)thiophene-3-carboxylic acid |
| InChIKey | HDZMVOKNJNGOLN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C(=O)NC3=C(C=CS3)C(=O)O |
Computed by PubChem (NCBI)