Products 744230-61-3

CAS 744230-61-3 is the registry number for 2-Cyclopropaneamido-4-phenylthiophene-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylic acid (CAS 744230-61-3) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylic acid. InChIKey: FHUQKMRHUMWWNN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO3S
Molecular weight287.3 g/mol
IUPAC name2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylic acid
InChIKeyFHUQKMRHUMWWNN-UHFFFAOYSA-N
SMILESC1CC1C(=O)NC2=C(C(=CS2)C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)