Products 66780-41-4
CAS 66780-41-4 is the registry number for 7-Hydroxy-2,6-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)-4H-chromen-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-hydroxy-2,6-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one (CAS 66780-41-4) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 7-hydroxy-2,6-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one. InChIKey: QYKSBIZYPYAIQF-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 7-hydroxy-2,6-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)chromen-4-one |
| InChIKey | QYKSBIZYPYAIQF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1O)OC(=C(C2=O)C3=CSC(=N3)C)C |
Computed by PubChem (NCBI)