CAS 307341-55-5 is the registry number for 2-(Benzoylamino)-5,6-dihydro-4h-cyclopenta[b]thiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid (CAS 307341-55-5) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid. InChIKey: JEEWRTJYBDZVBA-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
| InChIKey | JEEWRTJYBDZVBA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)O)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)