CAS 1712798-20-3 is the registry number for 2-(1-Benzofuran-2-yl)-4-propyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1-benzofuran-2-yl)-4-propyl-1,3-thiazole-5-carboxylic acid (CAS 1712798-20-3) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)-4-propyl-1,3-thiazole-5-carboxylic acid. InChIKey: MYKJFINNCXJLGQ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)-4-propyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | MYKJFINNCXJLGQ-UHFFFAOYSA-N |
| SMILES | CCCC1=C(SC(=N1)C2=CC3=CC=CC=C3O2)C(=O)O |
Computed by PubChem (NCBI)