Products 1016705-78-4
CAS 1016705-78-4 is the registry number for 3-((5-Aminopyridin-2-yl)oxy)benzonitrile. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-[(5-amino-2-pyridinyl)oxy]benzonitrile (CAS 1016705-78-4) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 3-[(5-amino-2-pyridinyl)oxy]benzonitrile. InChIKey: OZVJUKSPQVNLQT-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 3-[(5-amino-2-pyridinyl)oxy]benzonitrile |
| InChIKey | OZVJUKSPQVNLQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC=C(C=C2)N)C#N |
Computed by PubChem (NCBI)