Products 1017-05-6

CAS 1017-05-6 is the registry number for 5-(4-Hydroxyphenyl)oxazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(4-hydroxyphenyl)-1,3-oxazole-2-carboxylic acid (CAS 1017-05-6) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 5-(4-hydroxyphenyl)-1,3-oxazole-2-carboxylic acid. InChIKey: WYYPPCABRJJQCI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO4
Molecular weight205.17 g/mol
IUPAC name5-(4-hydroxyphenyl)-1,3-oxazole-2-carboxylic acid
InChIKeyWYYPPCABRJJQCI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CN=C(O2)C(=O)O)O

Computed by PubChem (NCBI)