Products 1017172-90-5
CAS 1017172-90-5 appears in our catalog under these names: 2，8-Dichloroquinoline-3-carboxylic acid, 97%, 97%, 2,8-Dichloroquinoline-3-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,8-dichloroquinoline-3-carboxylic acid (CAS 1017172-90-5) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 2,8-dichloroquinoline-3-carboxylic acid. InChIKey: BZFOZUIIVWTILB-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 2,8-dichloroquinoline-3-carboxylic acid |
| InChIKey | BZFOZUIIVWTILB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N=C2C(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)