Products 1017429-35-4
CAS 1017429-35-4 appears in our catalog under these names: 2,6-Dichloroquinoline-3-methanol, 95%, (2,6-Dichloroquinolin-3-yl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2,6-dichloroquinolin-3-yl)methanol (CAS 1017429-35-4) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: (2,6-dichloroquinolin-3-yl)methanol. InChIKey: RGVUMJRZROPQIV-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | (2,6-dichloroquinolin-3-yl)methanol |
| InChIKey | RGVUMJRZROPQIV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Cl)CO)Cl |
Computed by PubChem (NCBI)