CAS 2364585-01-1 is the registry number for 5-(2,6-Dichloro-4-methylphenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
5-(2,6-dichloro-4-methylphenyl)-1,3-oxazole (CAS 2364585-01-1) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 5-(2,6-dichloro-4-methylphenyl)-1,3-oxazole. InChIKey: RFKFPQULHHVYHJ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 5-(2,6-dichloro-4-methylphenyl)-1,3-oxazole |
| InChIKey | RFKFPQULHHVYHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)C2=CN=CO2)Cl |
Computed by PubChem (NCBI)