CAS 70049-46-6 appears in our catalog under these names: 2,4-Dichloro-6-methoxyquinoline, 95%, 2,4-Dichloro-6-methoxyquinoline 97%, 2,4-Dichloro-6-methoxyquinoline, 98%, 2,4-Dichloro-6-methoxyquinoline, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
2,4-dichloro-6-methoxyquinoline (CAS 70049-46-6) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 2,4-dichloro-6-methoxyquinoline. InChIKey: FUAYQQYYACASFP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,4-dichloro-6-methoxyquinoline |
| InChIKey | FUAYQQYYACASFP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)