CAS 55934-22-0 appears in our catalog under these names: 2,4-Dichloro-7-methoxyquinoline, 98%, 2,4–Dichloro–7–methoxyquinoline, 2,4-Dichloro-7-methoxyquinoline 95%, Quinoline, 2,4-dichloro-7-methoxy-, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2.5g, 500mg.
2,4-dichloro-7-methoxyquinoline (CAS 55934-22-0) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 2,4-dichloro-7-methoxyquinoline. InChIKey: XHKVDLMHZLUDSK-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,4-dichloro-7-methoxyquinoline |
| InChIKey | XHKVDLMHZLUDSK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)