Products 38693-11-7
CAS 38693-11-7 is the registry number for 2-Chloro-1-(5-chloro-1h-indol-3-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-chloro-1-(5-chloro-1H-indol-3-yl)ethanone (CAS 38693-11-7) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 2-chloro-1-(5-chloro-1H-indol-3-yl)ethanone. InChIKey: QZKPNTKNGLCGPJ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2-chloro-1-(5-chloro-1H-indol-3-yl)ethanone |
| InChIKey | QZKPNTKNGLCGPJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)C(=O)CCl |
Computed by PubChem (NCBI)