CAS 158000-98-7 appears in our catalog under these names: Quinoline-6-carbonyl chloride hydrochloride, 95%, Quinoline-6-carbonyl chloride hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
Quinoline-6-carbonyl chloride;hydrochloride (CAS 158000-98-7) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: quinoline-6-carbonyl chloride;hydrochloride. InChIKey: QXRUURIWNYPMGL-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | quinoline-6-carbonyl chloride;hydrochloride |
| InChIKey | QXRUURIWNYPMGL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)Cl)N=C1.Cl |
Computed by PubChem (NCBI)