CAS 1204-16-6 is the registry number for 6,8-dichloro-2-methylquinolin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,8-dichloro-2-methyl-1H-quinolin-4-one (CAS 1204-16-6) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 6,8-dichloro-2-methyl-1H-quinolin-4-one. InChIKey: VNMHNSLATBRUIG-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 6,8-dichloro-2-methyl-1H-quinolin-4-one |
| InChIKey | VNMHNSLATBRUIG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)