CAS 22091-36-7 appears in our catalog under these names: 4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g.
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole (CAS 22091-36-7) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole. InChIKey: BGGPUCCJQGIJRL-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-oxazole |
| InChIKey | BGGPUCCJQGIJRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CCl)Cl |
Computed by PubChem (NCBI)