CAS 1017777-45-5 appears in our catalog under these names: 4'-Chloro-2',6'-difluoroacetophenone, 97%, 4’–Chloro–2’,6’–difluoroacetophenone, 4'-Chloro-2',6'-difluoroacetophenone, 98%+,RG, 98%+,RG, 4'-Chloro-2',6'-difluoroacetophenone, 98%+,RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 500mg.
1-(4-chloro-2,6-difluorophenyl)ethanone (CAS 1017777-45-5) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 1-(4-chloro-2,6-difluorophenyl)ethanone. InChIKey: VEZAUYYYYPJSKR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 1-(4-chloro-2,6-difluorophenyl)ethanone |
| InChIKey | VEZAUYYYYPJSKR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1F)Cl)F |
Computed by PubChem (NCBI)