CAS 112857-70-2 appears in our catalog under these names: 2,4-Difluoro-3-methylbenzoyl chloride, 95%, 2,4-Difluoro-3-methylbenzoyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
2,4-difluoro-3-methylbenzoyl chloride (CAS 112857-70-2) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 2,4-difluoro-3-methylbenzoyl chloride. InChIKey: BMMDDDOEASRDKX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 2,4-difluoro-3-methylbenzoyl chloride |
| InChIKey | BMMDDDOEASRDKX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)C(=O)Cl)F |
Computed by PubChem (NCBI)