CAS 121872-94-4 appears in our catalog under these names: 2’–Chloro–4’,5’–difluoroacetophenone, 2'-Chloro-4',5'-difluoroacetophenone, 98%, 2'-Chloro-4',5'-difluoroacetophenone, 95%, 1-(2-Chloro-4,5-difluorophenyl)ethanone 98%, 1-(2-Chloro-4,5-difluorophenyl)ethanone, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g.
1-(2-chloro-4,5-difluorophenyl)ethanone (CAS 121872-94-4) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 1-(2-chloro-4,5-difluorophenyl)ethanone. InChIKey: BNODNMUCMFITCS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 1-(2-chloro-4,5-difluorophenyl)ethanone |
| InChIKey | BNODNMUCMFITCS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1Cl)F)F |
Computed by PubChem (NCBI)