CAS 1352755-21-5 is the registry number for 4-(Difluoromethyl)benzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)benzoyl chloride (CAS 1352755-21-5) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 4-(difluoromethyl)benzoyl chloride. InChIKey: UTBZKLFVSNRNEE-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 4-(difluoromethyl)benzoyl chloride |
| InChIKey | UTBZKLFVSNRNEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)F)C(=O)Cl |
Computed by PubChem (NCBI)