Products 1352755-21-5

CAS 1352755-21-5 is the registry number for 4-(Difluoromethyl)benzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(difluoromethyl)benzoyl chloride (CAS 1352755-21-5) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 4-(difluoromethyl)benzoyl chloride. InChIKey: UTBZKLFVSNRNEE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF2O
Molecular weight190.57 g/mol
IUPAC name4-(difluoromethyl)benzoyl chloride
InChIKeyUTBZKLFVSNRNEE-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(F)F)C(=O)Cl

Computed by PubChem (NCBI)