CAS 1373920-86-5 is the registry number for 6'-Chloro-2',3'-difluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(6-chloro-2,3-difluorophenyl)ethanone (CAS 1373920-86-5) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 1-(6-chloro-2,3-difluorophenyl)ethanone. InChIKey: MSWPVZQPVHBWRL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 1-(6-chloro-2,3-difluorophenyl)ethanone |
| InChIKey | MSWPVZQPVHBWRL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1F)F)Cl |
Computed by PubChem (NCBI)