CAS 116622-90-3 is the registry number for 2,6-Difluorophenylacetyl chloride, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 25g, 1g, 250mg.
2-(2,6-difluorophenyl)acetyl chloride (CAS 116622-90-3) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 2-(2,6-difluorophenyl)acetyl chloride. InChIKey: MQYPWHKXTAYWIT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)acetyl chloride |
| InChIKey | MQYPWHKXTAYWIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(=O)Cl)F |
Computed by PubChem (NCBI)