CAS 655-12-9 is the registry number for 4'-Chloro-2',5'-difluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-chloro-2,5-difluorophenyl)ethanone (CAS 655-12-9) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 1-(4-chloro-2,5-difluorophenyl)ethanone. InChIKey: XLBICEUZJHYFQG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 1-(4-chloro-2,5-difluorophenyl)ethanone |
| InChIKey | XLBICEUZJHYFQG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1F)Cl)F |
Computed by PubChem (NCBI)