CAS 1256352-85-8 appears in our catalog under these names: 4'-Chloro-3',5'-difluoroacetophenone, 95%, 4'-Chloro-3',5'-difluoroacetophenone, 1-(4-Chloro-3,5-difluorophenyl)ethanone, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g.
1-(4-chloro-3,5-difluorophenyl)ethanone (CAS 1256352-85-8) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 1-(4-chloro-3,5-difluorophenyl)ethanone. InChIKey: RKJDTCARHAMWIW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 1-(4-chloro-3,5-difluorophenyl)ethanone |
| InChIKey | RKJDTCARHAMWIW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)Cl)F |
Computed by PubChem (NCBI)