CAS 1017789-38-6 appears in our catalog under these names: tert–Butyl (4,6–dichloropyridin–2–yl)carbamate, tert-Butyl (4,6-dichloropyridin-2-yl)carbamate 97%, Carbamic acid, N-(4,6-dichloro-2-pyridinyl)-, 1,1-dimethylethyl ester, 97%, 97%, 2-Boc-Amino-4,6-dichloropyridine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Tert-butyl N-(4,6-dichloro-2-pyridinyl)carbamate (CAS 1017789-38-6) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: tert-butyl N-(4,6-dichloro-2-pyridinyl)carbamate. InChIKey: JFCFQIAVAYUUML-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | tert-butyl N-(4,6-dichloro-2-pyridinyl)carbamate |
| InChIKey | JFCFQIAVAYUUML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)