Products 1432680-09-5
CAS 1432680-09-5 is the registry number for 2-Amino-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-4-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-imino-5-(4-methylphenyl)-1,3-oxazolidin-4-one;dihydrochloride (CAS 1432680-09-5) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: 2-imino-5-(4-methylphenyl)-1,3-oxazolidin-4-one;dihydrochloride. InChIKey: HWLBKSMBBRBCGZ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 2-imino-5-(4-methylphenyl)-1,3-oxazolidin-4-one;dihydrochloride |
| InChIKey | HWLBKSMBBRBCGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C(=O)NC(=N)O2.Cl.Cl |
Computed by PubChem (NCBI)