CAS 1559062-01-9 is the registry number for 3-(1H-Benzimidazol-1-yl)propanoic acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(benzimidazol-1-yl)propanoic acid;dihydrochloride (CAS 1559062-01-9) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: 3-(benzimidazol-1-yl)propanoic acid;dihydrochloride. InChIKey: IYFRIQKHGDWLFF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 3-(benzimidazol-1-yl)propanoic acid;dihydrochloride |
| InChIKey | IYFRIQKHGDWLFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2CCC(=O)O.Cl.Cl |
Computed by PubChem (NCBI)