Products 1203499-43-7

CAS 1203499-43-7 is the registry number for tert-Butyl 3,4-dichloropyridin-2-ylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3,4-dichloro-2-pyridinyl)carbamate (CAS 1203499-43-7) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: tert-butyl N-(3,4-dichloro-2-pyridinyl)carbamate. InChIKey: GOYRULDGADITLD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12Cl2N2O2
Molecular weight263.12 g/mol
IUPAC nametert-butyl N-(3,4-dichloro-2-pyridinyl)carbamate
InChIKeyGOYRULDGADITLD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=NC=CC(=C1Cl)Cl

Computed by PubChem (NCBI)