Products 1177315-26-2
CAS 1177315-26-2 is the registry number for 5-(Aminomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(aminomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one;hydrochloride (CAS 1177315-26-2) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: 5-(aminomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one;hydrochloride. InChIKey: INAHGBXYKAWUPN-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 5-(aminomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one;hydrochloride |
| InChIKey | INAHGBXYKAWUPN-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=CC=C(C=C2)Cl)CN.Cl |
Computed by PubChem (NCBI)