Products 275383-96-5

CAS 275383-96-5 is the registry number for tert-Butyl 5,6-dichloropyridin-3-ylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(5,6-dichloro-3-pyridinyl)carbamate (CAS 275383-96-5) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: tert-butyl N-(5,6-dichloro-3-pyridinyl)carbamate. InChIKey: DKHGGFHSPXVTDE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12Cl2N2O2
Molecular weight263.12 g/mol
IUPAC nametert-butyl N-(5,6-dichloro-3-pyridinyl)carbamate
InChIKeyDKHGGFHSPXVTDE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC(=C(N=C1)Cl)Cl

Computed by PubChem (NCBI)