CAS 1803582-86-6 appears in our catalog under these names: 2-(Chloromethyl)-5,6-dimethoxy-1H-1,3-benzodiazole hydrochloride, 95%, 2-(Chloromethyl)-5,6-dimethoxy-1H-1,3-benzodiazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride (CAS 1803582-86-6) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: 2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride. InChIKey: WKHXKKNTGLVTOA-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride |
| InChIKey | WKHXKKNTGLVTOA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=N2)CCl)OC.Cl |
Computed by PubChem (NCBI)