CAS 1801693-96-8 is the registry number for tert-Butyl (5,6-dichloropyridin-2-yl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-(5,6-dichloro-2-pyridinyl)carbamate (CAS 1801693-96-8) is a chemical compound with the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. IUPAC name: tert-butyl N-(5,6-dichloro-2-pyridinyl)carbamate. InChIKey: KPVGSBWJGVRKFU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | tert-butyl N-(5,6-dichloro-2-pyridinyl)carbamate |
| InChIKey | KPVGSBWJGVRKFU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)