CAS 101819-51-6 is the registry number for 5-Bromo-8-hydroxy-3,4-dihydronaphthalen-1(2H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one (CAS 101819-51-6) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: QALFVVUGULYHSN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | QALFVVUGULYHSN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2C(=O)C1)O)Br |
Computed by PubChem (NCBI)