CAS 10189-78-3 appears in our catalog under these names: 6,11-Dihydro-5h-pyrido[2,3-b][1,5]benzodiazepin-5-one, 95%, 6,11-Dihydro-5H-benzo(b)pyrido(2,3-e)(1,4)diazepin-5-one, 95+%, 6,11–dihydropyrido(3,2–c)(1,5)benzodiazepin–5–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
6,11-dihydropyrido[3,2-c][1,5]benzodiazepin-5-one (CAS 10189-78-3) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 6,11-dihydropyrido[3,2-c][1,5]benzodiazepin-5-one. InChIKey: SFRAVXBSPHJEBZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6,11-dihydropyrido[3,2-c][1,5]benzodiazepin-5-one |
| InChIKey | SFRAVXBSPHJEBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(C=CC=N3)C(=O)N2 |
Computed by PubChem (NCBI)