CAS 791633-38-0 is the registry number for 10-Chloro-10,11-dihydro-5H-dibenzo(b,f)azepine-5-carboxamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide (CAS 791633-38-0) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 5-chloro-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide. InChIKey: SILOKTCUWIPXDK-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 5-chloro-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | SILOKTCUWIPXDK-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)N)Cl |
Computed by PubChem (NCBI)