Products 1019508-29-2
CAS 1019508-29-2 is the registry number for 1-(6-Nitropyridin-3-yl)piperidin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(6-nitro-3-pyridinyl)piperidin-4-one (CAS 1019508-29-2) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 1-(6-nitro-3-pyridinyl)piperidin-4-one. InChIKey: LNXHZQNFRZOOAW-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 1-(6-nitro-3-pyridinyl)piperidin-4-one |
| InChIKey | LNXHZQNFRZOOAW-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=CN=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)