CAS 1019656-18-8 appears in our catalog under these names: 5-(Thiophen-2-yl)-1,2-oxazole-3-carboxamide, 95%, 5-(Thiophen-2-yl)-1,2-oxazole-3-carboxamide, 5-(Thiophen-2-yl)-1,2-oxazole-3-carboxamide, 96%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 2,5g, 50mg.
5-thiophen-2-yl-1,2-oxazole-3-carboxamide (CAS 1019656-18-8) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 5-thiophen-2-yl-1,2-oxazole-3-carboxamide. InChIKey: QHUQPUCJZDGKSG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| InChIKey | QHUQPUCJZDGKSG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NO2)C(=O)N |
Computed by PubChem (NCBI)