CAS 1020719-89-4 appears in our catalog under these names: Sulfathiazole-d4, Sulfathiazole-d4 (benzene-d4), 98 atom % D, min 98% Chemical Purity, Sulfathiazole-d4, >95% (HPLC), Sulfathiazole D4, Sulfathiazole-d4, 99.91%. Offered by: Chemat Brand, CDN, TRC, GLPBio, TargetMol. Available pack sizes: on request, 0,01g, 0,005g, 2,5mg, 25mg, 1mg, 5mg, 10mg.
4-amino-2,3,5,6-tetradeuterio-N-(1,3-thiazol-2-yl)benzenesulfonamide (CAS 1020719-89-4) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 259.3 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuterio-N-(1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: JNMRHUJNCSQMMB-RHQRLBAQSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuterio-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | JNMRHUJNCSQMMB-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=NC=CS2)[2H] |
Computed by PubChem (NCBI)