Products 854137-71-6

CAS 854137-71-6 is the registry number for 2-(3-Mercapto-5-thien-2-yl-4h-1,2,4-triazol-4-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoic acid (CAS 854137-71-6) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoic acid. InChIKey: MTCPVWYULUALKM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O2S2
Molecular weight255.3 g/mol
IUPAC name2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoic acid
InChIKeyMTCPVWYULUALKM-UHFFFAOYSA-N
SMILESCC(C(=O)O)N1C(=NNC1=S)C2=CC=CS2

Computed by PubChem (NCBI)