CAS 146374-23-4 is the registry number for 3-Amino-N-(1,3-thiazol-2-yl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide (CAS 146374-23-4) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 3-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: SJBMOWNPZUTOKD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 3-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | SJBMOWNPZUTOKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=NC=CS2)N |
Computed by PubChem (NCBI)